QR questions

This forum made possible through the generous support of SDN members, donors, and sponsors. Thank you.

113zami

Full Member
10+ Year Member
15+ Year Member
Joined
Oct 4, 2007
Messages
141
Reaction score
0
Points
0
  1. Pre-Dental
Advertisement - Members don't see this ad

fig1
fig2



any help with these math problems will be greatly appreciated

1)why are these 2 sets of numbers "evenly spaced"?
set#1: x+2,x+4,x+6 set#2: 16,17,18,19,20,21

2)why isn't the least common multiple of 12 &15=90
isn't this how you do it:
12=2x2x3
15=3x5
So, 3x5x2x3=90 but they say its 60
i did it the exact same way as was shown in the example--> the least common multiple of 6,8,10
6=2x3
8=2x2x2
10=2x5 so, 2x2x2x3x5=120
note: i know to get the least common multiple you look at the multiples of the larger # until you reach a # that's common between them but why isn't the above method working?

3)log(base2)(x-16)=log(base4)(x-4) what's the value of x?
ansr:20
my question is about the first step of the correct ansr explanation which is to put everything in terms of log(base2)
so becomes: log(base2)(x-16)=log(base2)(x-4)/log(base2)(4)
how did log(base4)(x-4) become log(base2)(x-4)/log(base2)(4)
what property of logs did they use, I looked at the properties of logs but couldn't figure out which one they used

4)set S is the set of all points(x,y) in the coordinate plane such that x and y are both integers with absolute value less than 4. If one of these points is chosen at random, what is the probability that this point will be 2 units or less from the origin? ansr: 0.265
their ansr:
tot desired/tot possible=13/49=.265
total desired= (0,-2)(0,-1)(0,0)(0,1)(0,2)(-2,0)(-1,0)(1,0)(2,0)(-1,-1)(-1,1)
(1,-1)(1,1)
but what about these points: (2,1)(-2,1)(-2,-1)(2,-1) they are also 2 units or less from the origin why aren't they included with the desired values?

5)((n+2)!-(n+1)!)/n!=? ansr: (n+1)^2
Their solution: (n+2)(n+1)-(n+1)= (n+1)^2 which is only solving the numerator, where did the denominator go??

6)(fig2) if the area of the triangle is 15what is the length of AC? Ansr=6.2
This is how I did it:
Area=1/2 base(hight)
15=1/2 (CB)(AC)
30= (CB)(AC)
30/CB=AC
tan38=CB/(30/CB)
tan38=(CB)^2/30
CB=sqrt(30tan38)
CB=23.4
Therefore AC=30/23.4=1.2 which is not 6.2 what's wrong with this method, I know there is a shorter way but why is the above one wrong?

7)(fig1) what is the degree measure, to the nearest integer of angle ABO?
Ansr=40
In the process of attempting to understand their ansr, why is the length of OB=sqrt(2^2+3^2)I can't figure out which sides of which triangle are they using to come up with OB cuz if they're using the that main triangle already drawn then sqrt(2^2+3^2) should be the length of the hypotenuse not the length of OB?

thanks alot for the help,



 
1)why are these 2 sets of numbers "evenly spaced"?
set#1: x+2,x+4,x+6 set#2: 16,17,18,19,20,21

Because the difference between any 2 consecutive numbers are the same: (x+6) - (x+4) = (x+4) - (x+2) = 2 and for the second 21-20 = 20-19 = ... = 17-16 = 1.

2)why isn't the least common multiple of 12 &15=90
isn't this how you do it:
12=2x2x3
15=3x5
So, 3x5x2x3=90 but they say its 60
i did it the exact same way as was shown in the example--> the least common multiple of 6,8,10
6=2x3
8=2x2x2
10=2x5 so, 2x2x2x3x5=120
note: i know to get the least common multiple you look at the multiples of the larger # until you reach a # that's common between them but why isn't the above method working?

First of all you should have 180 with that method, not 90. Notice that you have a shared factor of 3 in both the 12 and the 15. Say I started you off with 180 and had you find the factors of it. You would say 180 = 2x2x3x3x5 (I don't know why you removed the 2 from the equation since it should stay there). I could then ask you to use some of those factors to make 12 and 15. You'd say 'okay, let me do 2x2x3 = 12 and 3x5 = 15.' But notice how you used the 3 in both of those. Did you really need to use both 3s that were in the equation or could you have used the same one both times? The answer is the latter. That's why you should come up with 60 instead of 180. Because both 12 and 15 use a factor of 3, so when you just take all their factors and multiply them together you are doubling it up. If instead you take all unique factors of each and then look at all the shared factors and count them only once, you'll get your LCD. In this case you'd have 2x2x3x5 = 60.

For the second example of 6, 8, 10... you have 2x3=6, 2x2x2=8, and 2x5=10. So the unique factors are 3, 2, 2, and 5 (yes, the two 2s are unique since the 6 and the 10 only have ONE factor of 2 while 8 has THREE, so two of those are unique to the 8). The shared factor is a 2. So you do 2x2x2x3x5 = 120.


3)log(base2)(x-16)=log(base4)(x-4) what's the value of x?
ansr:20
my question is about the first step of the correct ansr explanation which is to put everything in terms of log(base2)
so becomes: log(base2)(x-16)=log(base2)(x-4)/log(base2)(4)
how did log(base4)(x-4) become log(base2)(x-4)/log(base2)(4)
what property of logs did they use, I looked at the properties of logs but couldn't figure out which one they used

It's a property where [log(base a) y] = [log(base x) y] / [log(base x) a]. You can use any new base.

Statement: Let a^x = y and so log(a)y 'log base a of y' = x. I want to show that for some other base b, log(a)y = log(b)y / log(b)a.

Proof: Start with a^x = y. Take the log of both sides, base b. We get log(b)a^x = log(b)y. Simplify the left side using the exponent rule. We get x*log(b)a = log(b)y. Now divide: x = log(b)y / log(b)a. Finally we know that x = log(a)y, so we have log(a)y = log(b)y / log(b)a. QED.


4)set S is the set of all points(x,y) in the coordinate plane such that x and y are both integers with absolute value less than 4. If one of these points is chosen at random, what is the probability that this point will be 2 units or less from the origin? ansr: 0.265
their ansr:
tot desired/tot possible=13/49=.265
total desired= (0,-2)(0,-1)(0,0)(0,1)(0,2)(-2,0)(-1,0)(1,0)(2,0)(-1,-1)(-1,1)
(1,-1)(1,1)
but what about these points: (2,1)(-2,1)(-2,-1)(2,-1) they are also 2 units or less from the origin why aren't they included with the desired values?

Use the distance formula; they aren't. They aren't referring to either x or y, they are referring to the point itself and its distance from (0,0). If I gave you point (3,4) then the distance from the origin = 5 which is obviously bigger than both 3 and 4.

5)((n+2)!-(n+1)!)/n!=? ansr: (n+1)^2
Their solution: (n+2)(n+1)-(n+1)= (n+1)^2 which is only solving the numerator, where did the denominator go??

Because the exclamation point is the symbol for factorial. The term n! = n*(n-1)*(n-2)*...*2*1. So when you write all that out you have (n+2)(n+1)👎(n-1)...(2)(1) - (n+1)👎...(2)(1) all over 👎(n-1)...(2)(1). Notice how all terms have 👎(n-1)...(2)(1) in them. So they all cancel out. There goes your entire denominator. You are left with (n+2)(n+1) - (n+1) in the numerator which = (n+1)(n+2 - 1) = (n+1)^2.

6)(fig2) if the area of the triangle is 15what is the length of AC? Ansr=6.2
This is how I did it:
Area=1/2 base(hight)
15=1/2 (CB)(AC)
30= (CB)(AC)
30/CB=AC
tan38=CB/(30/CB)
tan38=(CB)^2/30
CB=sqrt(30tan38)
CB=23.4
Therefore AC=30/23.4=1.2 which is not 6.2 what's wrong with this method, I know there is a shorter way but why is the above one wrong?

23.4 is 30tan38. You didn't square root it. Otherwise you are correct.

7)(fig1) what is the degree measure, to the nearest integer of angle ABO?
Ansr=40
In the process of attempting to understand their ansr, why is the length of OB=sqrt(2^2+3^2)I can't figure out which sides of which triangle are they using to come up with OB cuz if they're using the that main triangle already drawn then sqrt(2^2+3^2) should be the length of the hypotenuse not the length of OB?

They are using the triangle on the x-y plane (the 'floor' of the drawing). So the distance formula is the same as if you were looking at a 2D graph with point = (2,3) and the origin. That is the distance of OB = sqrt(13). The distance of OA = 3. You want angle ABO so tan(ABO) = OA / OB = 3/sqrt(13). Answer = 39.76 which is approximately 40 degrees.
 
what can I say streetwolf THANK YOU THANK YOU THANK YOU it all make sense, I'll be posting up some more later
 
th_geom30001.jpg


th_geom4.jpg



th_geom5.jpg



th_geom6.jpg

figure1
figure2
figure3
figure4

9)(figure1)a circle of radius 1 is placed on an incline where point P, a point on the circle, has the coordinates (-5,-5). The circle is rolled up the incline, and once the circle hits the origin, the circle is then rolled horizontally along the x-axis to the right. What is the x-coordinate of the point where P touches the incline or the x-axis for the fifth time(not including the starting point)? Ansr:24.34

10)If f(x)=1/2(x-4) and f(g(x))=g(f(x)), which of the following can be g(x)?
I. 2x-1/4 II. 2x+8 III. 1/2(x-4)
a) I
b)II
c) II and III
ansr: c……III is easy but how do you get II?

11)when the number x is subtracted from each of the numbers 8,16, 40, the three numbers that result from a geometric progression. What is the value of x?
ansr: 4

12)(figure2) the function f is defined by f(x)=180/x+3 for x greater than or equal to zero, and f(x)=60 for x<0. the figure shows the graph of y=f(x). what is the sum of the areas of the three shaded rectangles? Ansr: 141
having trouble figuring out length of 1st rectangle, its 180/x+3 then substitute x=6 and solve, but shouldn't x= 3(not 6) because on the x-axis from x=3 to x=6 is just 3 units

13) if f(x)=2 then f(f^(-1)(x))=?
I don't have the ansr, but I am guessing the it doesn't have an inverse??

14)for all x, sinx+sin(x+pi)+sin(2pi+x)=? Ansr= sinx
but I think the ansr should be 3sinx because
sinx+sin(x+pi)+sin(2pi+x)
sinx+sinx+sinpi+sin2pi+sinx
sinpi=0 and sin2pi=0 so what's left over is 3sinx

15)for all y that doesn't equal 5, (y^(3)-6y^(2)+3y+10)/(y^(2)-10y+25)=?
Ansr: (y^(2)-y-2)/(y-5)

16)which of the following functions has a domain of x<or equal to 3?
a) f(x)=(3-x)^(1/4)+x/2
b) f(x)=(3-x)^(1/3)+x/4
ansr is A but why is B wrong, if you substitute x=2 and x=3 in to B you don't get zero answer or (-) under the radical, so it also has that domain, so how can you eliminate B ?

17)f(x)=x+4 and g(x)=6-x^2, what is the maximum value of g(f(x))?
A)-4
B)6
Ansr is B, for this type of problems to find min or max don't you just plug in the ansr choices into the equation and see which one gives you the min or max value? because that's what I did, where the g(f(x))=6-(x+4)^2 then substitute
a) x=-4 into 6-(x+4)^2 which gives you 6 and b) x= 6 into 6-(x+4)^2 gives you -94 so obviously 6 is more than -94 so why is A wrong?


18)if f(x)=(2x/5)+7/3, f^-1(x)=? Ansr: (15x-35)/6
according to their explanation:
1) replace f(x) with y then solve the equation for x in terms of y
2) replace x with f^(-1)(x) and replace y with x.
Which is what I did but keep getting the wrong answer,this is what I did:
1) f(x)=(2x/5)+7/3 becomes y=(2x/5)+7/3
2) y=(2x/5)+7/3
(5/2)y=(2x/5)(5/2)+7/3(5/2)
(5y/2)-35/6=x
2) (5y/2)-35/6=x becomes f^(-1)(x)= (5x/2)-35/6 which is not the ansr

19)(1-cos40)/2=? Ansr=sin^2(20)
use sinx/2=sqrt((1-cosx)/2) and
after squaring both sides becomes (sin^(2)x^(2))/4=(1-cosx)/2
replace x with 40 so becomes (sin^(2)40^(2))/4=(1-cos40)/2
and finally dividing out the left side I get (1-cos40)/2=sin^(2)400
and sin^(2)400 is not the answer

20)37/(4sqrt(x)-19)=37/17, x=?
A)72.25
B)81
Ansr is A, I think they did a mistake because following their method I get B,
They said since the numerators are equal the denominators must be equal so drop out the numerators and set the denominators equal to each other, which gives us:
4sqrt(x)-19=17 then solving for x gives x=72.25 but x should equal 81 right?

21)(figure3) In the triangle YVW, VX is the altitude to side YW, and ZW is the altitude to side YV. If VX=3, YV=4, ZW=5, what is the length of side YW? Ansr: 6.66
Ok, doesn't a perpendicular altitude automatically bisect its base? So to find YW I can just say that since YV=4 that means that ZY=2and sinceZW=5 now we have the lengths of 2 sides of a right triangle so I can just use the Pythagorean theorem to find the length of YW, but doing this I get the wrong answer

22)(figure4) what's the area of the triangle? Ansr: 3.07
I just don't understand their explanation, 1st step they do is drop and altitude from angleY going down to the base which therefore divides angle Y into 45degrees and 60 degrees, but shouldn't the perpendicular altitude bisect angle Y(I searched for this) ie divide it into equal parts, not divide it into unequal parts?
22) if sinx=1/2cosx, and 0<or equal to x<or equal to pi/2, what's the value of 1/2sinx? ansr: 0.22
Their ansr is:

1)Since sinx=1/2cosx
2) Sinx=1/2sqrt(1-sin^(2)x)----------&#224;where did sqrt(1-sin^(2)x) come from? I checked my identities but its not one of them
3) (sinx)^2=(1/2sqrt(1-sin^(2)x))^2
4) Sin^(2)x=1/4(1-sin^(2)x)-----------&#224;after squaring the left side shouldn't the x also be squared so it should be Sin^(2)x^2 ?
5) 4sin^(2)x=1-sin^(2)x then solve for sinx and finally divide that by 2 to find 1/2sinx

23) to graph f(x)=absolute value2-xabsolute value +1/2, they said the smallest the y coordinate can be is 1/2, how do they automatically know that? Is there a fast way to find the y coordinate without constructing a table, pick x values&#8230;etc. I know it's not a straight line so it can't follow y=mx+b format


thanks alot for any help (this is the last set)
 
9)(figure1)a circle of radius 1 is placed on an incline where point P, a point on the circle, has the coordinates (-5,-5). The circle is rolled up the incline, and once the circle hits the origin, the circle is then rolled horizontally along the x-axis to the right. What is the x-coordinate of the point where P touches the incline or the x-axis for the fifth time(not including the starting point)? Ansr:24.34

Radius = 1 so diameter = 2 which means circumference = 2pi. The length of the line drawn in is 5sqrt(2) ~ 7.07. So the circle could roll a bit over 1 time up that line before hitting the origin. Then it would continue to the right. When the circle rolls 5 times it will have covered a linear distance of 2pi * 5 = 10pi ~ 31.416 units. Once it gets past that slope it will be traveling straight across the x-axis. So it spends the first ~7.07 units on the slope and the other ~24.34 units on the x-axis. The exact answer is 10pi - 5sqrt(2).

10)If f(x)=1/2(x-4) and f(g(x))=g(f(x)), which of the following can be g(x)?
I. 2x-1/4 II. 2x+8 III. 1/2(x-4)
a) I
b)II
c) II and III
ansr: c……III is easy but how do you get II?

You just plug each of I, II, and III in for x in f(x) and then plug f(x) into x in each of I, II, and III. If the two answers match then that's an answer.

For (a) you have 2x-1/4. So plug that into 1/2(x-4) and you get 1/2(2x-1/4 - 4) = x - 17/8. When you swap it and plug 1/2(x-4) into 2x-1/4 you get 2(1/2(x-4)) - 1/4 = (x-4) - 1/4 = x - 17/4 which is clearly different.

For (b) you have 2x+8. Plugging that into 1/2(x-4) you get 1/2(2x+8 - 4) = x + 2. Now, plugging 1/2(x-4) into 2x+8 you get 2(1/2(x-4)) + 8 = (x-4) + 8 = x+4.

Those are different so II is also wrong. Either you typed something up wrongly or the answer itself is wrong. Another g(x) that would work is g(x) = 2(x+2) = 2x + 4.


11)when the number x is subtracted from each of the numbers 8,16, 40, the three numbers that result from a geometric progression. What is the value of x?
ansr: 4

Classic word problem. Just do what it says. You also need to know what a geometric progression is. It's when you have a, b, c such that c/b = b/a (could be more than 3 numbers). So (40-x)/(16-x) = (16-x)/(8-x). Then (16-x)^2 - (40-x)(8-x) = 0.

256 - 32x + x^2 - (320 - 48x + x^2) = 0.
16x - 64 = 0
x = 4

And so you have 4, 12, 36 which is a geometric progression since 36/12 = 12/4 = 3.


12)(figure2) the function f is defined by f(x)=180/x+3 for x greater than or equal to zero, and f(x)=60 for x<0. the figure shows the graph of y=f(x). what is the sum of the areas of the three shaded rectangles? Ansr: 141
having trouble figuring out length of 1st rectangle, its 180/x+3 then substitute x=6 and solve, but shouldn't x= 3(not 6) because on the x-axis from x=3 to x=6 is just 3 units

Area would be the length x width and the length of each would be the y values where they hit the curve. So for the first one you sub in x = 6 and get 20, for the second you sub in x = 9 and get 15, and for the third you sub in x = 12 and get 12. Add all three up and get 47. Multiply that by the common width of 3 and you get 141.

You use x = 6 for the first rectangle because the length of it (up/down measurement) extends up to the curve defined by 180/(x+3) at x value 6. If you plug in x = 3 you'll get the length of a rectangle which extends up to curve at point x = 3.

P.S. In regards to integration this would be finding the right Reimann sum from 3 to 12.


13) if f(x)=2 then f(f^(-1)(x))=?
I don't have the ansr, but I am guessing the it doesn't have an inverse??

You're right, there is no inverse of f(x) = 2. I'm not sure what this problem wants. Normally f(f^(-1)(x)) = x but that's provided that f(x) and f(-1)(x) both exist, which they don't here.

14)for all x, sinx+sin(x+pi)+sin(2pi+x)=? Ansr= sinx
but I think the ansr should be 3sinx because
sinx+sin(x+pi)+sin(2pi+x)
sinx+sinx+sinpi+sin2pi+sinx
sinpi=0 and sin2pi=0 so what's left over is 3sinx

You can't use distributive laws on trig functions. What you should recognize is that by adding x+pi within a sine function, you are 'moving' it halfway around the circle. This will always negate your value. So sin(x+pi) is just -sin(x). And when you add 2pi+x, you are moving all the way around the circle, exactly one loop around. So your value does not change. You still have sin(x). So sin(x) - sin(x) + sin(x) = sin(x).

As a double check, there's a rule that says sin(a + b) = sin(a)cos(b) + sin(b)cos(a). For sin(x+pi) this would come to sin(x)cos(pi) + sin(pi)cos(x). Since cos(pi) = -1 and sin(pi) = 0 this simplifies to just -sin(x).

sin(2pi + x) = sin(2pi)cos(x) + sin(x)cos(2pi). Since sin(2pi) = 0 and cos(2pi) = 1 this simplifies to just sin(x).


15)for all y that doesn't equal 5, (y^(3)-6y^(2)+3y+10)/(y^(2)-10y+25)=?
Ansr: (y^(2)-y-2)/(y-5)

The denominator is (y-5)^2. Since they obviously want you to simplify, I would bank on the fact that (y-5) is a factor of the numerator. You can use long or synthetic division, or just plain out guess. Whatever you do, you end up with y^2 - y - 2.

If you just couldn't make that deduction there are other ways. The rational roots theorem states that any rational roots of a polynomial are of the form +- q/p where q = any factor of the constant term and p = any factor of the coefficient of the leading polynomial term (term with the highest power). So in this, q would be any factor of 10 and p would be any factor of 1. This leaves us with +- (10, 5, 2, or 1). You might get lucky and find the answer right away or it might take you all 8 tries. Either way you'll eventually get it.




That's all for now, more later.
 
Holy jeebus! Does the QR have questions similar to these? If so....I'm getting a 12. :scared:
 
Part 2


16)which of the following functions has a domain of x<or equal to 3?
a) f(x)=(3-x)^(1/4)+x/2
b) f(x)=(3-x)^(1/3)+x/4
ansr is A but why is B wrong, if you substitute x=2 and x=3 in to B you don't get zero answer or (-) under the radical, so it also has that domain, so how can you eliminate B ?

Because it's the cube root which allows negative signs. If I asked for the cube root of -8 you'd tell me -2. You can't take the square root, fourth root, sixth root, etc of a negative number and get a real number answer. All values of x will work in B.

17)f(x)=x+4 and g(x)=6-x^2, what is the maximum value of g(f(x))?
A)-4
B)6
Ansr is B, for this type of problems to find min or max don't you just plug in the ansr choices into the equation and see which one gives you the min or max value? because that's what I did, where the g(f(x))=6-(x+4)^2 then substitute
a) x=-4 into 6-(x+4)^2 which gives you 6 and b) x= 6 into 6-(x+4)^2 gives you -94 so obviously 6 is more than -94 so why is A wrong?

It wants the maximum value of g(f(x)) and not the value of x for which that occurs. The maximum value of g(f(x)) would be the greatest possible value of 6-(x+4)^2, considering all possible x values.

Since (x+4)^2 is a squared function, all values are non-negative. The lowest value that (x+4)^2 can be is 0 when x = -4 (choice A which tricked you). This gives you the greatest value of g(f(x)) = 6 (choice B).


18)if f(x)=(2x/5)+7/3, f^-1(x)=? Ansr: (15x-35)/6
according to their explanation:
1) replace f(x) with y then solve the equation for x in terms of y
2) replace x with f^(-1)(x) and replace y with x.
Which is what I did but keep getting the wrong answer,this is what I did:
1) f(x)=(2x/5)+7/3 becomes y=(2x/5)+7/3
2) y=(2x/5)+7/3
(5/2)y=(2x/5)(5/2)+7/3(5/2)
(5y/2)-35/6=x
2) (5y/2)-35/6=x becomes f^(-1)(x)= (5x/2)-35/6 which is not the ansr

Yes that IS the same answer. I'm going to ream you on this one because you can't afford to miss these questions. You gotta take the extra step sometimes and look at what they've written. The first thing to realize is that the 35 and the 6 are both there and their answer is written in one term. The next logical thing to do would be to see if they combined two terms into one. Lo and behold, they did. Find the LCD of 2 and 6 and combine your answer into one term.

19)(1-cos40)/2=? Ansr=sin^2(20)
use sinx/2=sqrt((1-cosx)/2) and
after squaring both sides becomes (sin^(2)x^(2))/4=(1-cosx)/2
replace x with 40 so becomes (sin^(2)40^(2))/4=(1-cos40)/2
and finally dividing out the left side I get (1-cos40)/2=sin^(2)400
and sin^(2)400 is not the answer

First of all the rule is sin(x/2), not sin(x) / 2. Second of all, sine is a trig function, and the values in parenthesis are not able to partake in the distributive law unless it occurs within them. For example if you have sin(2(x+4)) then that equals sin(2x+8). But if you have 2x(sin(4x)) then you do NOT have 2xsin(8x^2) - you have just 2xsin(4x).

When you square sin(x/2) you simply get sin^2(x/2). That's it. This is a huge thing and you better remember it!!! You also can't do that with cos, tan, or log/ln functions. There are others too but those are the big ones.

You get sin^2(x/2) = 1-cos(x) / 2. Sub in x = 40 and you get your answer.


20)37/(4sqrt(x)-19)=37/17, x=?
A)72.25
B)81
Ansr is A, I think they did a mistake because following their method I get B,
They said since the numerators are equal the denominators must be equal so drop out the numerators and set the denominators equal to each other, which gives us:
4sqrt(x)-19=17 then solving for x gives x=72.25 but x should equal 81 right?

I get 81. Must be a mistake.

21)(figure3) In the triangle YVW, VX is the altitude to side YW, and ZW is the altitude to side YV. If VX=3, YV=4, ZW=5, what is the length of side YW? Ansr: 6.66
Ok, doesn't a perpendicular altitude automatically bisect its base? So to find YW I can just say that since YV=4 that means that ZY=2and sinceZW=5 now we have the lengths of 2 sides of a right triangle so I can just use the Pythagorean theorem to find the length of YW, but doing this I get the wrong answer

A perpendicular altitude does not automatically bisect its base.

Actually this is easier than you think. The area is 1/2 * b * h and you have both values from YV = 4 and ZW = 5. So the area is 10. Now you also have VX = 3 and you need YW (the base). So (1/2)(3)(b) = 10 means 3/2(b) = 10 so b = 2/3(10) = 6.66(7) = your answer.


22)(figure4) what's the area of the triangle? Ansr: 3.07
I just don't understand their explanation, 1st step they do is drop and altitude from angleY going down to the base which therefore divides angle Y into 45degrees and 60 degrees, but shouldn't the perpendicular altitude bisect angle Y(I searched for this) ie divide it into equal parts, not divide it into unequal parts?

You have your 'facts' all wrong and I would review them carefully. A perpendicular altitude does not necessarily bisect anything. An angle bisector will bisect the angle and a perpendicular bisector will certainly bisect a line segment as it runs perpendicular to it. But this particular perpendicular altitude does none of the above. In fact, the name is redundant since by definition the altitude is perpendicular to the base it joins with.

When you need to find the area you MUST have a base and a height (altitude). You need the latter. So the first thing to do is drop that line down. To confirm that 105 isn't being broken into two equal values, note the 30 degrees of angle X. Coupled with the 90 degrees created from the perp altitude, you are left with 60 degrees for the third angle. If the perp altitude meets XZ at point W, then angle XWY is your 90 degree right angle. That means WYX is 60 degrees. Perfect. That's a nice triangle to have. The 30-60-90. You know that this triangle has measurements of 1-sqrt(3)-2 where 1 is the side opposite the 30 degree angle, sqrt(3) is the side opposite the 60 degree angle, and 2 is the hypotenuse. Of course this is a ratio. Since the actual hypotenuse is 3, the ratio has been boosted by a factor of 3/2. So each term of the ratio goes up by 3/2 and we get 3/2 - 3sqrt(3)/2 - 3. Since we want the altitude right now, we look for the smallest number since that side is opposite 30 degrees. YW = 3/2.

Look at triangle WYZ. Since angle X is 30 and angle Y is 105, angle Z is 45 degrees. Since YWZ is a 90 degree right angle, angle WYZ must be 45 degrees. This is the 45-45-90 or the 1-1-sqrt(2) triangle where both sides are the same value. If WY = 3/2 then so does WZ.

Looking back to the 30-60-90 triangle, we want XW. This is the side opposite 60 degrees so we want the second value = 3sqrt(3)/2. That's the length of XW. Add that to the length of WZ and you get the length of XZ = 3/2 + (3/2)(sqrt(3)). To find the area, take (1/2)bh. That value just before was the base. The height is the altitude which we found to be 3/2. Do the math and you get 9/8 + 9/8(sqrt(3)) ~ 3.07.


23) if sinx=1/2cosx, and 0<or equal to x<or equal to pi/2, what's the value of 1/2sinx? ansr: 0.22
Their ansr is:

1)Since sinx=1/2cosx
2) Sinx=1/2sqrt(1-sin^(2)x)----------àwhere did sqrt(1-sin^(2)x) come from? I checked my identities but its not one of them
3) (sinx)^2=(1/2sqrt(1-sin^(2)x))^2
4) Sin^(2)x=1/4(1-sin^(2)x)-----------àafter squaring the left side shouldn’t the x also be squared so it should be Sin^(2)x^2 ?
5) 4sin^(2)x=1-sin^(2)x then solve for sinx and finally divide that by 2 to find 1/2sinx

1) Duh
2) sin^2 + cos^2 = 1, review that one. Note that the 'sinx = 1/2' part hasn't changed between (1) and (2) which means they replaced cos(x).
3) Duh, just squared both sides.
4) I mentioned this a few problems up. The x stays unsquared. Review your notes.
5) Moved stuff around.

To solve for sin(x) you have 5sin^2(x) = 1 so sin^2(x) = 1/5 so sin(x) = 1/sqrt(5). You want 1/2 sin(x) which is half that value ~ 0.22.


24) to graph f(x)=absolute value2-xabsolute value +1/2, they said the smallest the y coordinate can be is 1/2, how do they automatically know that? Is there a fast way to find the y coordinate without constructing a table, pick x values…etc. I know it's not a straight line so it can't follow y=mx+b format

Since 2-x is absolute value, it is always non-negative. The lowest possible value it can be is 0 (when x = 2). Since you have that plus 1/2, the value of y can never be lower than 1/2 since |2+x| will either add 0 or a positive number. Adding 0 keeps it at 1/2 so that's the lowest value of y.
 
Hey Street,
Do you have any book recs for QR? Or did you just go by previous knowledge?
 
Advertisement - Members don't see this ad
Math has always come naturally to me. I have a degree in it now if that means anything haha.

I'd recommend SAT workbooks. Same material more or less. Also make sure you have a DAT study guide as well for the small handful of topics that may not be covered in the SAT.
 
For #9 I don't really understand what they're asking for, my understanding is that the starting point of the circle is at point P then it starts rolling up the incline and continues up to the origin and continues along the x-axis until the total distance is 31.41 then it stops at that position on the xaxis. From the begining of the path to the end, after the starting point, point P touches the incline again only once then for the remaining 4 rotations it touches the xaxis 4 times, then stops. so why does the question say "What is the x-coordinate of the point where P touches the incline OR the x-axis&#8230;."

do they want the x coordinate when point p touches the xaxis OR when it touches the incline?? because there are a total of 5 different x coordinates/points that P touches, one of them is on the incline and the remaining 4 are on the x axis. and even if they want the x coordinate when p touches the xaxis, which point on the x axis, there are 4 of them that P touches on the xaxis....I hope you know what i mean, i know i didn't explain it well

total path of P is:

________P1__O_____P2_____P3_____P4______P5
_incline______O_____x-axis___________________

O= origin

#10 yes i typed it wrong it should be f(x)=1/2(x)-4 not f(x)=1/2(x-4)

#18 uh oh, me and my silly mistakes

Thank you so much for taking the time to explain those for me, you should never leave sdn
 
For #9 I don't really understand what they're asking for, my understanding is that the starting point of the circle is at point P then it starts rolling up the incline and continues up to the origin and continues along the x-axis until the total distance is 31.41 then it stops at that position on the xaxis. From the begining of the path to the end, after the starting point, point P touches the incline again only once then for the remaining 4 rotations it touches the xaxis 4 times, then stops. so why does the question say "What is the x-coordinate of the point where P touches the incline OR the x-axis&#8230;."

do they want the x coordinate when point p touches the xaxis OR when it touches the incline?? because there are a total of 5 different x coordinates/points that P touches, one of them is on the incline and the remaining 4 are on the x axis. and even if they want the x coordinate when p touches the xaxis, which point on the x axis, there are 4 of them that P touches on the xaxis....I hope you know what i mean, i know i didn't explain it well

total path of P is:

________P1__O_____P2_____P3_____P4______P5
_incline______O_____x-axis___________________

O= origin

#10 yes i typed it wrong it should be f(x)=1/2(x)-4 not f(x)=1/2(x-4)

#18 uh oh, me and my silly mistakes

Thank you so much for taking the time to explain those for me, you should never leave sdn

#9)

Picture rolling a big ball up a small straight hill (slope = 1 as in the example) and at the top of the hill (the origin) the land flattens out again (slope = 0). Now picture the single point of the ball which touches the ground before you started rolling it. Pretend you marked it with a sharpie or something. Now picture the ball rolling as you watch that marked point go around and around. When it rolls around 5 complete times (so it is back on the ground), where is the ball located?

First the ball travels up the slope so it makes sense to find the distance of the slope. With point (-5, -5) the distance formula says D = 5sqrt(2). Now the ball is at the origin. From now on it travels straight across level ground (the x-axis). If it travels 5 units, then you'll be on (5,0). If it travels another 2.443 units you'll then be on (7.443,0). And so on.

You want the ball to roll around 5 times. The radius is 1 so the diameter is 2 which means the circumference is 2pi units. So when the ball makes 1 complete rotation, it has rolled 2pi units down a straight line (why?).

When it rolls 5 complete times, it has rolled 5*2pi = 10pi units down a straight line. So you want the ball to move 10pi units down a straight line. The initial slope is a straight line of 5sqrt(2) units. So how many units are left?

10pi - 5sqrt(2) units are left to roll. Since we start at (0,0) after the slope and travel along the x-axis, we'll end up at point (10pi-5sqrt(2), 0).

The x-coordinate will be just that: 10pi-5sqrt(2) ~ 24.34 units.

It says incline *OR* x-axis because it doesn't want to give anything away to you for free. You have to figure out which one it's going to land on when it finishes the 5th rotation. But yes, the first full rotation is still on the incline and the other 4 are all on the x-axis.

===

And x/2 - 4 is the other one. g(x) = 2x + 8

So g(f(x)) = 2(x/2 - 4) + 8 = x - 8 + 8 = x
And f(g(x)) = 1/2(2x + 8) - 4 = x + 4 - 4 = x

Since g(f(x)) = f(g(x)) = x, the two functions are inverses of each other.

Check by doing y = x/2 - 4
Flip them: x = y/2 - 4
Solve for y: x + 4 = y/2
y = 2x + 8

So 2x + 8 is the inverse of x/2 - 4.
 
perfect, thank you

I just found one more,last question
it says that this function has an inverse, f(x)=x^(3)+3x^(2)+3x and we need to find its f^-1(x)=? like that problem #18
I have posted previously, so i replace f(x) with y then i solve for x in terms of y, but how do i do that, its impossible, no matter how i manipulate it i just can't get x by itself, so how can I find f^-1(x)=?
 
f(x)=x^(3)+3x^(2)+3x

x = y^3 + 3y^2 + 3y
x + 1 = y^3 + 3y^2 + 3y + 1 (this step requires some thought)
x + 1 = (y + 1)^3
(x + 1)^(1/3) = (y + 1)


y = (x + 1)^(1/3) - 1

So y = (cube root of [x+1]) - 1

That's the inverse.

Took me a minute to notice that I could complete the cube by adding 1 to both sides.
 
Top Bottom