Question: OChem IUPAC Nomenclature

This forum made possible through the generous support of SDN members, donors, and sponsors. Thank you.

jasminetea7

Full Member
10+ Year Member
Advertisement - Members don't see this ad
So far, I've been studying with Kaplan BB, and I took some of their subject tests. One question goes,

The IUPAC name for the compound below is..?


CH3-CH2-CH(CH2CH3)-CH2-CH2-C(CH3)2-CH3


And the answer (according to the answer sheet) is 5-Ethyl-2,2-Dimethylheptane.

But I was just watching Chad's video and he was saying that the prefixes (di-, tri-, etc.) should be counted when alphabetizing.

In that case, the answer for above question should be 2,2-Dimethyl-5-Ethylheptane.

Which way is the correct way(counting the prefix when alphabetizing or not)????
 
I've always learned that things like di-, tri-, tetra-, tert- and sec- are NOT alphabetized

things like iso- and neo- ARE

EDIT: sorry chemnerd98 got in before me 🙂