TBR Orgo Ch 4 passage 2

[jsmith1]

---

Members do not see this ad.

My questions is for number 9.. if you dont have the book the question compares 2-methylheptadecane to 8-Dodecen-1-yl acetate. Which one has more primary carbons?

I know 2-methylheptadecane has 3 but doest 8-Dodecen-1-yl acetate also have 3 primary Carbons? Isnt the sp2 hybridized carbon attached of the carbonyl also primary because it is attached to one other carbon?

 

[Ninblades]

My questions is for number 9.. if you dont have the book the question compares 2-methylheptadecane to 8-Dodecen-1-yl acetate. Which one has more primary carbons?

I know 2-methylheptadecane has 3 but doest 8-Dodecen-1-yl acetate also have 3 primary Carbons? Isnt the sp2 hybridized carbon attached of the carbonyl also primary because it is attached to one other carbon?

Yes it is, but 8-Dodecen-1-yl acetate has 4 primary carbons: CH3CHOOCH2(CH2)7CHCH(CH2)2CH3

The bolded carbons atoms are all primary b/c they have 1 carbon neighbor.

 

[krogers21]

Yes it is, but 8-Dodecen-1-yl acetate has 4 primary carbons: CH3CHOOCH2(CH2)7CHCH(CH2)2CH3

The bolded carbons atoms are all primary b/c they have 1 carbon neighbor.

Is the dodecyl alkyl groups even required for the MCAT? I always understood it to be up to 10 C chains.
In any regard, what are these "-yl" and "dodecen" groups? Upon looking up the compound, I would have named it 1-acetoxy-8-dodecene. I understand what dodecene is, but dodecen? also this -yl group and the naming leads me to believe this naming is due to the dodecenyl group being referenced as the "addition" to the ester as I will call it rather than the acetoxy group being an addition to the alkene. So, if my rambling isn't confusing enough, could anyone explain this to me?

Oh, and sorry OP if I am commandeering this post.